C19H25N3O2 — CID 70639004
4-[4-(1-pyrrolidin-1-ylpropan-2-yloxy)phenoxy]benzene-1,2-diamine (PubChem CID 70639004) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-[4-(1-pyrrolidin-1-ylpropan-2-yloxy)phenoxy]benzene-1,2-diamine.
| Compound Name | 4-[4-(1-pyrrolidin-1-ylpropan-2-yloxy)phenoxy]benzene-1,2-diamine |
|---|---|
| PubChem CID | 70639004 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 4-[4-(1-pyrrolidin-1-ylpropan-2-yloxy)phenoxy]benzene-1,2-diamine |
| SMILES | CC(CN1CCCC1)Oc1ccc(Oc2ccc(N)c(N)c2)cc1 |
| InChI | InChI=1S/C19H25N3O2/c1-14(13-22-10-2-3-11-22)23-15-4-6-16(7-5-15)24-17-8-9-18(20)19(21)12-17/h4-9,12,14H,2-3,10-11,13,20-21H2,1H3 |
| InChIKey | VZZUHIMCOAGSDJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|