C14H14ClN — CID 7063961
(4S)-4-chloro-9-methyl-1,2,3,4-tetrahydroacridine (PubChem CID 7063961) has the molecular formula C14H14ClN and a molecular weight of 231.73 g/mol. Its IUPAC name is (4S)-4-chloro-9-methyl-1,2,3,4-tetrahydroacridine.
| Compound Name | (4S)-4-chloro-9-methyl-1,2,3,4-tetrahydroacridine |
|---|---|
| PubChem CID | 7063961 |
| Molecular Formula | C14H14ClN |
| Molecular Weight | 231.73 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | (4S)-4-chloro-9-methyl-1,2,3,4-tetrahydroacridine |
| SMILES | Cc1c2c(nc3ccccc13)[C@@H](Cl)CCC2 |
| InChI | InChI=1S/C14H14ClN/c1-9-10-5-2-3-8-13(10)16-14-11(9)6-4-7-12(14)15/h2-3,5,8,12H,4,6-7H2,1H3/t12-/m0/s1 |
| InChIKey | ZEWLLWQVPGSFHQ-LBPRGKRZSA-N |
| XLogP | 4.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.73 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|