C10H14N2O — CID 70639979
7-ethyl-5-methoxy-1H-1,3-diazonine (PubChem CID 70639979) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 7-ethyl-5-methoxy-1H-1,3-diazonine.
| Compound Name | 7-ethyl-5-methoxy-1H-1,3-diazonine |
|---|---|
| PubChem CID | 70639979 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 7-ethyl-5-methoxy-1H-1,3-diazonine |
| SMILES | CCc1cc[nH]cncc(OC)c1 |
| InChI | InChI=1S/C10H14N2O/c1-3-9-4-5-11-8-12-7-10(6-9)13-2/h4-8H,3H2,1-2H3,(H,11,12)/b5-4-,9-6-,10-7+ |
| InChIKey | MDGQUKSJLCJOQN-NZPKQRPTSA-N |
| XLogP | 2.11 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |