C17H18N2O5 — CID 70640663
benzyl 2-[(5-oxo-2H-furan-3-yl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 70640663) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is benzyl 2-[(5-oxo-2H-furan-3-yl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-[(5-oxo-2H-furan-3-yl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70640663 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | benzyl 2-[(5-oxo-2H-furan-3-yl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | O=C1C=C(NC(=O)C2CCCN2C(=O)OCc2ccccc2)CO1 |
| InChI | InChI=1S/C17H18N2O5/c20-15-9-13(11-23-15)18-16(21)14-7-4-8-19(14)17(22)24-10-12-5-2-1-3-6-12/h1-3,5-6,9,14H,4,7-8,10-11H2,(H,18,21) |
| InChIKey | AKKFOPCPQBHDOO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |