C25H33BN4O5 — CID 70640752
tert-butyl (2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-7-yl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 70640752) has the molecular formula C25H33BN4O5 and a molecular weight of 480.37 g/mol. Its IUPAC name is tert-butyl (2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-7-yl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-7-yl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70640752 |
| Molecular Formula | C25H33BN4O5 |
| Molecular Weight | 480.37 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | tert-butyl (2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-7-yl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1c1ncc(-c2ccc(B3OC(C)(C)C(C)(C)O3)c3ncoc23)[nH]1 |
| InChI | InChI=1S/C25H33BN4O5/c1-23(2,3)33-22(31)30-12-8-9-18(30)21-27-13-17(29-21)15-10-11-16(19-20(15)32-14-28-19)26-34-24(4,5)25(6,7)35-26/h10-11,13-14,18H,8-9,12H2,1-7H3,(H,27,29)/t18-/m0/s1 |
| InChIKey | PJVSAMSREDKLRA-SFHVURJKSA-N |
| XLogP | 4.59 |
| TPSA | 102.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|