C26H37BN4O5 — CID 123872070
tert-butyl N-propyl-N-[1-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-7-yl]-1H-imidazol-2-yl]ethyl]carbamate (PubChem CID 123872070) has the molecular formula C26H37BN4O5 and a molecular weight of 496.42 g/mol. Its IUPAC name is tert-butyl N-propyl-N-[1-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-7-yl]-1H-imidazol-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-propyl-N-[1-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-7-yl]-1H-imidazol-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 123872070 |
| Molecular Formula | C26H37BN4O5 |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | tert-butyl N-propyl-N-[1-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-7-yl]-1H-imidazol-2-yl]ethyl]carbamate |
| SMILES | CCCN(C(=O)OC(C)(C)C)C(C)c1ncc(-c2ccc(B3OC(C)(C)C(C)(C)O3)c3ncoc23)[nH]1 |
| InChI | InChI=1S/C26H37BN4O5/c1-10-13-31(23(32)34-24(3,4)5)16(2)22-28-14-19(30-22)17-11-12-18(20-21(17)33-15-29-20)27-35-25(6,7)26(8,9)36-27/h11-12,14-16H,10,13H2,1-9H3,(H,28,30) |
| InChIKey | FXENHNDRYIBTFS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 102.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|