C20H30N2 — CID 70641759
2,3-bis(3,3-dimethylbutan-2-yl)quinoxaline (PubChem CID 70641759) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is 2,3-bis(3,3-dimethylbutan-2-yl)quinoxaline.
| Compound Name | 2,3-bis(3,3-dimethylbutan-2-yl)quinoxaline |
|---|---|
| PubChem CID | 70641759 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 2,3-bis(3,3-dimethylbutan-2-yl)quinoxaline |
| SMILES | CC(c1nc2ccccc2nc1C(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H30N2/c1-13(19(3,4)5)17-18(14(2)20(6,7)8)22-16-12-10-9-11-15(16)21-17/h9-14H,1-8H3 |
| InChIKey | YIIGDALCLLLMPK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |