C17H30N2O2S — CID 70646193
N-[2-[3-(4-aminobutyl)-5-tert-butylphenyl]ethyl]methanesulfonamide (PubChem CID 70646193) has the molecular formula C17H30N2O2S and a molecular weight of 326.51 g/mol. Its IUPAC name is N-[2-[3-(4-aminobutyl)-5-tert-butylphenyl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[3-(4-aminobutyl)-5-tert-butylphenyl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 70646193 |
| Molecular Formula | C17H30N2O2S |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | N-[2-[3-(4-aminobutyl)-5-tert-butylphenyl]ethyl]methanesulfonamide |
| SMILES | CC(C)(C)c1cc(CCCCN)cc(CCNS(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H30N2O2S/c1-17(2,3)16-12-14(7-5-6-9-18)11-15(13-16)8-10-19-22(4,20)21/h11-13,19H,5-10,18H2,1-4H3 |
| InChIKey | RWHMNZPQZRPODE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|