C16H25F3N2 — CID 66581896
4-[3-(1-amino-2,2,2-trifluoroethyl)-5-tert-butylphenyl]butan-1-amine (PubChem CID 66581896) has the molecular formula C16H25F3N2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 4-[3-(1-amino-2,2,2-trifluoroethyl)-5-tert-butylphenyl]butan-1-amine.
| Compound Name | 4-[3-(1-amino-2,2,2-trifluoroethyl)-5-tert-butylphenyl]butan-1-amine |
|---|---|
| PubChem CID | 66581896 |
| Molecular Formula | C16H25F3N2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 4-[3-(1-amino-2,2,2-trifluoroethyl)-5-tert-butylphenyl]butan-1-amine |
| SMILES | CC(C)(C)c1cc(CCCCN)cc(C(N)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H25F3N2/c1-15(2,3)13-9-11(6-4-5-7-20)8-12(10-13)14(21)16(17,18)19/h8-10,14H,4-7,20-21H2,1-3H3 |
| InChIKey | QTMXOVLZPNWISO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|