C16H28N2 — CID 118527280
1-[3-(4-aminobutyl)-5-methylphenyl]-2,2-dimethylpropan-1-amine (PubChem CID 118527280) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 1-[3-(4-aminobutyl)-5-methylphenyl]-2,2-dimethylpropan-1-amine.
| Compound Name | 1-[3-(4-aminobutyl)-5-methylphenyl]-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 118527280 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 1-[3-(4-aminobutyl)-5-methylphenyl]-2,2-dimethylpropan-1-amine |
| SMILES | Cc1cc(CCCCN)cc(C(N)C(C)(C)C)c1 |
| InChI | InChI=1S/C16H28N2/c1-12-9-13(7-5-6-8-17)11-14(10-12)15(18)16(2,3)4/h9-11,15H,5-8,17-18H2,1-4H3 |
| InChIKey | MYCREHMUFBCWQY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|