C20H24N2O2S — CID 70651732
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 3-anilino-2-thiophen-2-ylpropanoate (PubChem CID 70651732) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 3-anilino-2-thiophen-2-ylpropanoate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 3-anilino-2-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 70651732 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 3-anilino-2-thiophen-2-ylpropanoate |
| SMILES | O=C(O[C@H]1CN2CCC1CC2)C(CNc1ccccc1)c1cccs1 |
| InChI | InChI=1S/C20H24N2O2S/c23-20(24-18-14-22-10-8-15(18)9-11-22)17(19-7-4-12-25-19)13-21-16-5-2-1-3-6-16/h1-7,12,15,17-18,21H,8-11,13-14H2/t17?,18-/m0/s1 |
| InChIKey | OJCRXNCFIUEORN-ZVAWYAOSSA-N |
| XLogP | 3.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |