C11H18N2O4S — CID 70658350
1-methoxy-4-methyl-2-[(2R)-1-(sulfamoylamino)propan-2-yl]oxybenzene (PubChem CID 70658350) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is 1-methoxy-4-methyl-2-[(2R)-1-(sulfamoylamino)propan-2-yl]oxybenzene.
| Compound Name | 1-methoxy-4-methyl-2-[(2R)-1-(sulfamoylamino)propan-2-yl]oxybenzene |
|---|---|
| PubChem CID | 70658350 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-methoxy-4-methyl-2-[(2R)-1-(sulfamoylamino)propan-2-yl]oxybenzene |
| SMILES | COc1ccc(C)cc1O[C@H](C)CNS(N)(=O)=O |
| InChI | InChI=1S/C11H18N2O4S/c1-8-4-5-10(16-3)11(6-8)17-9(2)7-13-18(12,14)15/h4-6,9,13H,7H2,1-3H3,(H2,12,14,15)/t9-/m1/s1 |
| InChIKey | PDOKDAGIQVHVMO-SECBINFHSA-N |
| XLogP | 0.56 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |