C15H23N3O4S — CID 7065895
[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetate (PubChem CID 7065895) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is [(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetate.
| Compound Name | [(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 7065895 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | [(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetate |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@H]1OC(=O)CSc1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H23N3O4S/c1-8(2)10-5-4-9(3)6-11(10)22-12(19)7-23-14-13(20)16-15(21)18-17-14/h8-11H,4-7H2,1-3H3,(H2,16,18,20,21)/t9-,10-,11-/m1/s1 |
| InChIKey | NCVQSAHEYFICTM-GMTAPVOTSA-N |
| XLogP | 1.55 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |