C16H25N3O4S — CID 6551656
[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanoate (PubChem CID 6551656) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanoate.
| Compound Name | [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 6551656 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanoate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@@H]1OC(=O)[C@@H](C)Sc1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H25N3O4S/c1-8(2)11-6-5-9(3)7-12(11)23-15(21)10(4)24-14-13(20)17-16(22)19-18-14/h8-12H,5-7H2,1-4H3,(H2,17,19,20,22)/t9-,10-,11+,12+/m1/s1 |
| InChIKey | UXEDYYWVDVLBNH-WYUUTHIRSA-N |
| XLogP | 1.94 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |