C13H25N6O2+ — CID 7067003
[(4S)-4-[(6-amino-5-nitropyrimidin-4-yl)amino]pentyl]-diethylazanium (PubChem CID 7067003) has the molecular formula C13H25N6O2+ and a molecular weight of 297.38 g/mol. Its IUPAC name is [(4S)-4-[(6-amino-5-nitropyrimidin-4-yl)amino]pentyl]-diethylazanium.
| Compound Name | [(4S)-4-[(6-amino-5-nitropyrimidin-4-yl)amino]pentyl]-diethylazanium |
|---|---|
| PubChem CID | 7067003 |
| Molecular Formula | C13H25N6O2+ |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | [(4S)-4-[(6-amino-5-nitropyrimidin-4-yl)amino]pentyl]-diethylazanium |
| SMILES | CC[NH+](CC)CCC[C@H](C)Nc1ncnc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H24N6O2/c1-4-18(5-2)8-6-7-10(3)17-13-11(19(20)21)12(14)15-9-16-13/h9-10H,4-8H2,1-3H3,(H3,14,15,16,17)/p+1/t10-/m0/s1 |
| InChIKey | FKJUDAMJFOFLRM-JTQLQIEISA-O |
| XLogP | 0.47 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|