C26H21F3N2O5 — CID 70673106
4-[(3aR,4S,7R,7aS)-4-(2-hydroxyethyl)-1,3-dioxo-7-(phenylmethoxymethyl)-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 70673106) has the molecular formula C26H21F3N2O5 and a molecular weight of 498.46 g/mol. Its IUPAC name is 4-[(3aR,4S,7R,7aS)-4-(2-hydroxyethyl)-1,3-dioxo-7-(phenylmethoxymethyl)-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(3aR,4S,7R,7aS)-4-(2-hydroxyethyl)-1,3-dioxo-7-(phenylmethoxymethyl)-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 70673106 |
| Molecular Formula | C26H21F3N2O5 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 4-[(3aR,4S,7R,7aS)-4-(2-hydroxyethyl)-1,3-dioxo-7-(phenylmethoxymethyl)-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@@]2(COCc4ccccc4)C=C[C@]3(CCO)O2)cc1C(F)(F)F |
| InChI | InChI=1S/C26H21F3N2O5/c27-26(28,29)19-12-18(7-6-17(19)13-30)31-22(33)20-21(23(31)34)25(9-8-24(20,36-25)10-11-32)15-35-14-16-4-2-1-3-5-16/h1-9,12,20-21,32H,10-11,14-15H2/t20-,21+,24+,25-/m0/s1 |
| InChIKey | QLIRQHRLTYRLLJ-JMLJLYKJSA-N |
| XLogP | 3.36 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|