C28H26F3N3O4 — CID 153033528
4-[(3aR,7aS)-7-(2-cyanoethyl)-1-hydroxy-3-oxo-4-(2-phenylmethoxyethyl)-3a,5,6,7a-tetrahydro-1H-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 153033528) has the molecular formula C28H26F3N3O4 and a molecular weight of 525.53 g/mol. Its IUPAC name is 4-[(3aR,7aS)-7-(2-cyanoethyl)-1-hydroxy-3-oxo-4-(2-phenylmethoxyethyl)-3a,5,6,7a-tetrahydro-1H-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(3aR,7aS)-7-(2-cyanoethyl)-1-hydroxy-3-oxo-4-(2-phenylmethoxyethyl)-3a,5,6,7a-tetrahydro-1H-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 153033528 |
| Molecular Formula | C28H26F3N3O4 |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 4-[(3aR,7aS)-7-(2-cyanoethyl)-1-hydroxy-3-oxo-4-(2-phenylmethoxyethyl)-3a,5,6,7a-tetrahydro-1H-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#CCCC12CCC(CCOCc3ccccc3)(O1)[C@@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(O)[C@@H]12 |
| InChI | InChI=1S/C28H26F3N3O4/c29-28(30,31)21-15-20(8-7-19(21)16-33)34-24(35)22-23(25(34)36)27(11-10-26(22,38-27)9-4-13-32)12-14-37-17-18-5-2-1-3-6-18/h1-3,5-8,15,22-24,35H,4,9-12,14,17H2/t22-,23+,24?,26?,27?/m1/s1 |
| InChIKey | VEGQXVTYAHQWDO-SJCPWBCKSA-N |
| XLogP | 4.69 |
| TPSA | 106.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|