C21H20O5S2 — CID 70673380
2-[2-(3-propylsulfonylphenyl)-4-thiophen-3-ylphenoxy]acetic acid (PubChem CID 70673380) has the molecular formula C21H20O5S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[2-(3-propylsulfonylphenyl)-4-thiophen-3-ylphenoxy]acetic acid.
| Compound Name | 2-[2-(3-propylsulfonylphenyl)-4-thiophen-3-ylphenoxy]acetic acid |
|---|---|
| PubChem CID | 70673380 |
| Molecular Formula | C21H20O5S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 2-[2-(3-propylsulfonylphenyl)-4-thiophen-3-ylphenoxy]acetic acid |
| SMILES | CCCS(=O)(=O)c1cccc(-c2cc(-c3ccsc3)ccc2OCC(=O)O)c1 |
| InChI | InChI=1S/C21H20O5S2/c1-2-10-28(24,25)18-5-3-4-16(11-18)19-12-15(17-8-9-27-14-17)6-7-20(19)26-13-21(22)23/h3-9,11-12,14H,2,10,13H2,1H3,(H,22,23) |
| InChIKey | NTDMRPCWEPWUBK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |