C34H35N2O4P — CID 70674378
[(R)-[(3S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-3-yl]-quinolin-4-ylmethyl] anthracene-9-carboxylate;phosphonous acid (PubChem CID 70674378) has the molecular formula C34H35N2O4P and a molecular weight of 566.64 g/mol. Its IUPAC name is [(R)-[(3S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-3-yl]-quinolin-4-ylmethyl] anthracene-9-carboxylate;phosphonous acid.
| Compound Name | [(R)-[(3S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-3-yl]-quinolin-4-ylmethyl] anthracene-9-carboxylate;phosphonous acid |
|---|---|
| PubChem CID | 70674378 |
| Molecular Formula | C34H35N2O4P |
| Molecular Weight | 566.64 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | [(R)-[(3S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-3-yl]-quinolin-4-ylmethyl] anthracene-9-carboxylate;phosphonous acid |
| SMILES | CC[C@H]1CN2CC[C@@H]1[C@H]([C@@H](OC(=O)c1c3ccccc3cc3ccccc13)c1ccnc3ccccc13)C2.OPO |
| InChI | InChI=1S/C34H32N2O2.H3O2P/c1-2-22-20-36-18-16-25(22)30(21-36)33(29-15-17-35-31-14-8-7-13-28(29)31)38-34(37)32-26-11-5-3-9-23(26)19-24-10-4-6-12-27(24)32;1-3-2/h3-15,17,19,22,25,30,33H,2,16,18,20-21H2,1H3;1-3H/t22-,25-,30+,33-;/m0./s1 |
| InChIKey | GIVYQYMZQGQAII-VAKZPYNMSA-N |
| XLogP | 6.90 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.64 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|