C29H30N2O5 — CID 23736805
[(5-ethenyl-1-azabicyclo[2.2.2]octan-3-yl)-(6-methoxyquinolin-4-yl)methyl] 2-acetyloxybenzoate (PubChem CID 23736805) has the molecular formula C29H30N2O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is [(5-ethenyl-1-azabicyclo[2.2.2]octan-3-yl)-(6-methoxyquinolin-4-yl)methyl] 2-acetyloxybenzoate.
| Compound Name | [(5-ethenyl-1-azabicyclo[2.2.2]octan-3-yl)-(6-methoxyquinolin-4-yl)methyl] 2-acetyloxybenzoate |
|---|---|
| PubChem CID | 23736805 |
| Molecular Formula | C29H30N2O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | [(5-ethenyl-1-azabicyclo[2.2.2]octan-3-yl)-(6-methoxyquinolin-4-yl)methyl] 2-acetyloxybenzoate |
| SMILES | C=CC1CN2CCC1C(C(OC(=O)c1ccccc1OC(C)=O)c1ccnc3ccc(OC)cc13)C2 |
| InChI | InChI=1S/C29H30N2O5/c1-4-19-16-31-14-12-21(19)25(17-31)28(22-11-13-30-26-10-9-20(34-3)15-24(22)26)36-29(33)23-7-5-6-8-27(23)35-18(2)32/h4-11,13,15,19,21,25,28H,1,12,14,16-17H2,2-3H3 |
| InChIKey | BERSPZMAPBQUBZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|