C26H27FN2O2 — CID 172966221
(R)-[(3S,4R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-3-yl]-[2-(4-fluorophenyl)-6-methoxyquinolin-4-yl]methanol (PubChem CID 172966221) has the molecular formula C26H27FN2O2 and a molecular weight of 418.51 g/mol. Its IUPAC name is (R)-[(3S,4R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-3-yl]-[2-(4-fluorophenyl)-6-methoxyquinolin-4-yl]methanol.
| Compound Name | (R)-[(3S,4R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-3-yl]-[2-(4-fluorophenyl)-6-methoxyquinolin-4-yl]methanol |
|---|---|
| PubChem CID | 172966221 |
| Molecular Formula | C26H27FN2O2 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | (R)-[(3S,4R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-3-yl]-[2-(4-fluorophenyl)-6-methoxyquinolin-4-yl]methanol |
| SMILES | C=C[C@H]1CN2CC[C@H]1[C@H]([C@@H](O)c1cc(-c3ccc(F)cc3)nc3ccc(OC)cc13)C2 |
| InChI | InChI=1S/C26H27FN2O2/c1-3-16-14-29-11-10-20(16)23(15-29)26(30)22-13-25(17-4-6-18(27)7-5-17)28-24-9-8-19(31-2)12-21(22)24/h3-9,12-13,16,20,23,26,30H,1,10-11,14-15H2,2H3/t16-,20+,23+,26-/m0/s1 |
| InChIKey | XAJAHMDPLMPZBG-LFSWIFPCSA-N |
| XLogP | 4.84 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|