C10H8O5 — CID 70676635
7-hydroxy-2-oxo-3,4-dihydrochromene-4-carboxylic acid (PubChem CID 70676635) has the molecular formula C10H8O5 and a molecular weight of 208.17 g/mol. Its IUPAC name is 7-hydroxy-2-oxo-3,4-dihydrochromene-4-carboxylic acid.
| Compound Name | 7-hydroxy-2-oxo-3,4-dihydrochromene-4-carboxylic acid |
|---|---|
| PubChem CID | 70676635 |
| Molecular Formula | C10H8O5 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 7-hydroxy-2-oxo-3,4-dihydrochromene-4-carboxylic acid |
| SMILES | O=C1CC(C(=O)O)c2ccc(O)cc2O1 |
| InChI | InChI=1S/C10H8O5/c11-5-1-2-6-7(10(13)14)4-9(12)15-8(6)3-5/h1-3,7,11H,4H2,(H,13,14) |
| InChIKey | WSZBNBRFHOJIKZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|