C15H19NO6 — CID 58265195
2-[2-[2-(7-hydroxy-2-oxo-3,4-dihydrochromen-4-yl)ethoxy]ethoxy]acetamide (PubChem CID 58265195) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-[2-[2-(7-hydroxy-2-oxo-3,4-dihydrochromen-4-yl)ethoxy]ethoxy]acetamide.
| Compound Name | 2-[2-[2-(7-hydroxy-2-oxo-3,4-dihydrochromen-4-yl)ethoxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 58265195 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 2-[2-[2-(7-hydroxy-2-oxo-3,4-dihydrochromen-4-yl)ethoxy]ethoxy]acetamide |
| SMILES | NC(=O)COCCOCCC1CC(=O)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C15H19NO6/c16-14(18)9-21-6-5-20-4-3-10-7-15(19)22-13-8-11(17)1-2-12(10)13/h1-2,8,10,17H,3-7,9H2,(H2,16,18) |
| InChIKey | NPOCHWKUEMAFJG-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|