C9H11F5OS — CID 70677073
3-[3-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-ol (PubChem CID 70677073) has the molecular formula C9H11F5OS and a molecular weight of 262.24 g/mol. Its IUPAC name is 3-[3-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-ol.
| Compound Name | 3-[3-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 70677073 |
| Molecular Formula | C9H11F5OS |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 3-[3-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-ol |
| SMILES | OCCCc1cccc(S(F)(F)(F)(F)F)c1 |
| InChI | InChI=1S/C9H11F5OS/c10-16(11,12,13,14)9-5-1-3-8(7-9)4-2-6-15/h1,3,5,7,15H,2,4,6H2 |
| InChIKey | TVESUFYCLBXDNK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |