3-cyclopropyl-6-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid

C11H11NO2S — CID 70681839

IUPAC3-cyclopropyl-6-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid
SMILESCc1c(C(=O)O)[nH]c2c(C3CC3)csc12
InChIInChI=1S/C11H11NO2S/c1-5-8(11(13)14)12-9-7(6-2-3-6)4-15-10(5)9/h4,6,12H,2-3H2,1H3,(H,13,14)
InChIKeyFMVDSUJWEDWDQD-UHFFFAOYSA-N
MW221.28 g/mol
LogP3.11
Rot. Bonds2

About 3-cyclopropyl-6-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid

3-cyclopropyl-6-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 70681839) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is 3-cyclopropyl-6-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid.

Molecular Properties

Compound Name3-cyclopropyl-6-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid
PubChem CID70681839
Molecular FormulaC11H11NO2S
Molecular Weight221.28 g/mol
Exact Mass221.05
IUPAC Name3-cyclopropyl-6-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid
SMILESCc1c(C(=O)O)[nH]c2c(C3CC3)csc12
InChIInChI=1S/C11H11NO2S/c1-5-8(11(13)14)12-9-7(6-2-3-6)4-15-10(5)9/h4,6,12H,2-3H2,1H3,(H,13,14)
InChIKeyFMVDSUJWEDWDQD-UHFFFAOYSA-N
XLogP3.11
TPSA53.09 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.28
LogP ≤ 53.11
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-cyclopropyl-6-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-cyclopropyl-6-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
The IUPAC name of 3-cyclopropyl-6-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid (CID 70681839) is 3-cyclopropyl-6-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid.
What is the SMILES notation for 3-cyclopropyl-6-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
The canonical SMILES for 3-cyclopropyl-6-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid is Cc1c(C(=O)O)[nH]c2c(C3CC3)csc12.
What is the InChIKey of 3-cyclopropyl-6-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
The InChIKey is FMVDSUJWEDWDQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2S/c1-5-8(11(13)14)12-9-7(6-2-3-6)4-15-10(5)9/h4,6,12H,2-3H2,1H3,(H,13,14).
What are the key properties of 3-cyclopropyl-6-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
3-cyclopropyl-6-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid has a molecular weight of 221.28 g/mol, XLogP of 3.11, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-6-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid is sourced from PubChem (CID 70681839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).