C26H33F3N2O3 — CID 70683781
4-[3-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]propyl]oxane-4-carboxylic acid (PubChem CID 70683781) has the molecular formula C26H33F3N2O3 and a molecular weight of 478.56 g/mol. Its IUPAC name is 4-[3-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]propyl]oxane-4-carboxylic acid.
| Compound Name | 4-[3-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]propyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 70683781 |
| Molecular Formula | C26H33F3N2O3 |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 4-[3-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]propyl]oxane-4-carboxylic acid |
| SMILES | C[C@H]1c2c([nH]c3ccc(C(F)(F)F)cc23)C[C@H]2CCN(CCCC3(C(=O)O)CCOCC3)C[C@@H]21 |
| InChI | InChI=1S/C26H33F3N2O3/c1-16-20-15-31(9-2-6-25(24(32)33)7-11-34-12-8-25)10-5-17(20)13-22-23(16)19-14-18(26(27,28)29)3-4-21(19)30-22/h3-4,14,16-17,20,30H,2,5-13,15H2,1H3,(H,32,33)/t16-,17-,20-/m1/s1 |
| InChIKey | OAGMVCCGAJTQIV-MBOZVWFJSA-N |
| XLogP | 5.45 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|