C18H20O4 — CID 70688376
(4-hydroxyphenyl) 2-[(1R,5R)-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]acetate (PubChem CID 70688376) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is (4-hydroxyphenyl) 2-[(1R,5R)-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]acetate.
| Compound Name | (4-hydroxyphenyl) 2-[(1R,5R)-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 70688376 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (4-hydroxyphenyl) 2-[(1R,5R)-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]acetate |
| SMILES | CC/C=C\C[C@H]1C(=O)C=C[C@H]1CC(=O)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C18H20O4/c1-2-3-4-5-16-13(6-11-17(16)20)12-18(21)22-15-9-7-14(19)8-10-15/h3-4,6-11,13,16,19H,2,5,12H2,1H3/b4-3-/t13-,16+/m0/s1 |
| InChIKey | DXCOZXPDCJJMBX-FEIQTHJPSA-N |
| XLogP | 3.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|