C14H19ClO4 — CID 91884633
2-hydroxyethyl 2-[3-chloro-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]acetate (PubChem CID 91884633) has the molecular formula C14H19ClO4 and a molecular weight of 286.75 g/mol. Its IUPAC name is 2-hydroxyethyl 2-[3-chloro-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]acetate.
| Compound Name | 2-hydroxyethyl 2-[3-chloro-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 91884633 |
| Molecular Formula | C14H19ClO4 |
| Molecular Weight | 286.75 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-hydroxyethyl 2-[3-chloro-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]acetate |
| SMILES | CC/C=C\CC1C(=O)C(Cl)=CC1CC(=O)OCCO |
| InChI | InChI=1S/C14H19ClO4/c1-2-3-4-5-11-10(8-12(15)14(11)18)9-13(17)19-7-6-16/h3-4,8,10-11,16H,2,5-7,9H2,1H3/b4-3- |
| InChIKey | UYXXQXQMZHKRGA-ARJAWSKDSA-N |
| XLogP | 2.21 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.75 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|