About 2-[3-(2-hydroxyethyl)-2-pent-2-enylimidazolidin-1-yl]ethyl hex-3-enoate
2-[3-(2-hydroxyethyl)-2-pent-2-enylimidazolidin-1-yl]ethyl hex-3-enoate (PubChem CID 72574945) has the molecular formula C18H32N2O3
and a molecular weight of 324.47 g/mol. Its IUPAC name is 2-[3-(2-hydroxyethyl)-2-pent-2-enylimidazolidin-1-yl]ethyl hex-3-enoate.
Molecular Properties
| Compound Name | 2-[3-(2-hydroxyethyl)-2-pent-2-enylimidazolidin-1-yl]ethyl hex-3-enoate |
| PubChem CID | 72574945 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | 2-[3-(2-hydroxyethyl)-2-pent-2-enylimidazolidin-1-yl]ethyl hex-3-enoate |
| SMILES | CCC=CCC(=O)OCCN1CCN(CCO)C1CC=CCC |
| InChI | InChI=1S/C18H32N2O3/c1-3-5-7-9-17-19(13-15-21)11-12-20(17)14-16-23-18(22)10-8-6-4-2/h5-8,17,21H,3-4,9-16H2,1-2H3 |
| InChIKey | APXMWZCKAQESII-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(2-hydroxyethyl)-2-pent-2-enylimidazolidin-1-yl]ethyl hex-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2-hydroxyethyl)-2-pent-2-enylimidazolidin-1-yl]ethyl hex-3-enoate?
The IUPAC name of 2-[3-(2-hydroxyethyl)-2-pent-2-enylimidazolidin-1-yl]ethyl hex-3-enoate (CID 72574945) is 2-[3-(2-hydroxyethyl)-2-pent-2-enylimidazolidin-1-yl]ethyl hex-3-enoate.
What is the SMILES notation for 2-[3-(2-hydroxyethyl)-2-pent-2-enylimidazolidin-1-yl]ethyl hex-3-enoate?
The canonical SMILES for 2-[3-(2-hydroxyethyl)-2-pent-2-enylimidazolidin-1-yl]ethyl hex-3-enoate is CCC=CCC(=O)OCCN1CCN(CCO)C1CC=CCC.
What is the InChIKey of 2-[3-(2-hydroxyethyl)-2-pent-2-enylimidazolidin-1-yl]ethyl hex-3-enoate?
The InChIKey is APXMWZCKAQESII-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N2O3/c1-3-5-7-9-17-19(13-15-21)11-12-20(17)14-16-23-18(22)10-8-6-4-2/h5-8,17,21H,3-4,9-16H2,1-2H3.
What are the key properties of 2-[3-(2-hydroxyethyl)-2-pent-2-enylimidazolidin-1-yl]ethyl hex-3-enoate?
2-[3-(2-hydroxyethyl)-2-pent-2-enylimidazolidin-1-yl]ethyl hex-3-enoate has a molecular weight of 324.47 g/mol, XLogP of 2.18, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-hydroxyethyl)-2-pent-2-enylimidazolidin-1-yl]ethyl hex-3-enoate is sourced from PubChem (CID 72574945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).