C25H19NO3S — CID 70689620
2-[4-(3-oxo-2,3-diphenylpropyl)phenyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 70689620) has the molecular formula C25H19NO3S and a molecular weight of 413.50 g/mol. Its IUPAC name is 2-[4-(3-oxo-2,3-diphenylpropyl)phenyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[4-(3-oxo-2,3-diphenylpropyl)phenyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 70689620 |
| Molecular Formula | C25H19NO3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 2-[4-(3-oxo-2,3-diphenylpropyl)phenyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(-c2ccc(CC(C(=O)c3ccccc3)c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C25H19NO3S/c27-23(19-9-5-2-6-10-19)21(18-7-3-1-4-8-18)15-17-11-13-20(14-12-17)24-26-22(16-30-24)25(28)29/h1-14,16,21H,15H2,(H,28,29) |
| InChIKey | XERPIZMHGPHYJL-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |