C22H26N2O3 — CID 70694576
1-[(1R,3S,11R,15S)-6-hydroxy-16-oxa-4,14-diazahexacyclo[12.5.2.03,11.05,10.011,15.015,19]henicosa-5(10),6,8,18-tetraen-4-yl]butan-1-one (PubChem CID 70694576) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 1-[(1R,3S,11R,15S)-6-hydroxy-16-oxa-4,14-diazahexacyclo[12.5.2.03,11.05,10.011,15.015,19]henicosa-5(10),6,8,18-tetraen-4-yl]butan-1-one.
| Compound Name | 1-[(1R,3S,11R,15S)-6-hydroxy-16-oxa-4,14-diazahexacyclo[12.5.2.03,11.05,10.011,15.015,19]henicosa-5(10),6,8,18-tetraen-4-yl]butan-1-one |
|---|---|
| PubChem CID | 70694576 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-[(1R,3S,11R,15S)-6-hydroxy-16-oxa-4,14-diazahexacyclo[12.5.2.03,11.05,10.011,15.015,19]henicosa-5(10),6,8,18-tetraen-4-yl]butan-1-one |
| SMILES | CCCC(=O)N1c2c(O)cccc2[C@]23CCN4CC[C@H](C[C@H]12)C1=CCO[C@]143 |
| InChI | InChI=1S/C22H26N2O3/c1-2-4-19(26)24-18-13-14-7-10-23-11-9-21(18,22(23)15(14)8-12-27-22)16-5-3-6-17(25)20(16)24/h3,5-6,8,14,18,25H,2,4,7,9-13H2,1H3/t14-,18+,21-,22+/m1/s1 |
| InChIKey | YSJIADOCDVFEDQ-SHYZFUQISA-N |
| XLogP | 2.93 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|