C18H29N5O3 — CID 70698526
methyl 5-(furan-2-ylmethylamino)-5-(1-pentyltetrazol-5-yl)hexanoate (PubChem CID 70698526) has the molecular formula C18H29N5O3 and a molecular weight of 363.46 g/mol. Its IUPAC name is methyl 5-(furan-2-ylmethylamino)-5-(1-pentyltetrazol-5-yl)hexanoate.
| Compound Name | methyl 5-(furan-2-ylmethylamino)-5-(1-pentyltetrazol-5-yl)hexanoate |
|---|---|
| PubChem CID | 70698526 |
| Molecular Formula | C18H29N5O3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | methyl 5-(furan-2-ylmethylamino)-5-(1-pentyltetrazol-5-yl)hexanoate |
| SMILES | CCCCCn1nnnc1C(C)(CCCC(=O)OC)NCc1ccco1 |
| InChI | InChI=1S/C18H29N5O3/c1-4-5-6-12-23-17(20-21-22-23)18(2,11-7-10-16(24)25-3)19-14-15-9-8-13-26-15/h8-9,13,19H,4-7,10-12,14H2,1-3H3 |
| InChIKey | ADKPMNYCVMZGKG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|