C22H24N2O4S — CID 70698581
2-[benzyl-(2-oxo-2-thiophen-2-ylacetyl)amino]-N-cyclopentyl-3-oxobutanamide (PubChem CID 70698581) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is 2-[benzyl-(2-oxo-2-thiophen-2-ylacetyl)amino]-N-cyclopentyl-3-oxobutanamide.
| Compound Name | 2-[benzyl-(2-oxo-2-thiophen-2-ylacetyl)amino]-N-cyclopentyl-3-oxobutanamide |
|---|---|
| PubChem CID | 70698581 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2-[benzyl-(2-oxo-2-thiophen-2-ylacetyl)amino]-N-cyclopentyl-3-oxobutanamide |
| SMILES | CC(=O)C(C(=O)NC1CCCC1)N(Cc1ccccc1)C(=O)C(=O)c1cccs1 |
| InChI | InChI=1S/C22H24N2O4S/c1-15(25)19(21(27)23-17-10-5-6-11-17)24(14-16-8-3-2-4-9-16)22(28)20(26)18-12-7-13-29-18/h2-4,7-9,12-13,17,19H,5-6,10-11,14H2,1H3,(H,23,27) |
| InChIKey | OZQWPVSUYMLGOP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|