C14H15F3NO2+ — CID 7070334
5,5,5-trifluoro-4-hydroxy-3-[(1S)-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]pent-3-en-2-one (PubChem CID 7070334) has the molecular formula C14H15F3NO2+ and a molecular weight of 286.27 g/mol. Its IUPAC name is 5,5,5-trifluoro-4-hydroxy-3-[(1S)-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]pent-3-en-2-one.
| Compound Name | 5,5,5-trifluoro-4-hydroxy-3-[(1S)-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]pent-3-en-2-one |
|---|---|
| PubChem CID | 7070334 |
| Molecular Formula | C14H15F3NO2+ |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 5,5,5-trifluoro-4-hydroxy-3-[(1S)-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]pent-3-en-2-one |
| SMILES | CC(=O)C(=C(O)C(F)(F)F)[C@H]1[NH2+]CCc2ccccc21 |
| InChI | InChI=1S/C14H14F3NO2/c1-8(19)11(13(20)14(15,16)17)12-10-5-3-2-4-9(10)6-7-18-12/h2-5,12,18,20H,6-7H2,1H3/p+1/t12-/m0/s1 |
| InChIKey | QWROJKNWWMZIRU-LBPRGKRZSA-O |
| XLogP | 1.81 |
| TPSA | 53.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|