About 2-[2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)ethyl]-6-phenyl-4,5-dihydropyridazin-3-one
2-[2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)ethyl]-6-phenyl-4,5-dihydropyridazin-3-one (PubChem CID 70705601) has the molecular formula C21H29N3O3
and a molecular weight of 371.48 g/mol. Its IUPAC name is 2-[2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)ethyl]-6-phenyl-4,5-dihydropyridazin-3-one.
Molecular Properties
| Compound Name | 2-[2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)ethyl]-6-phenyl-4,5-dihydropyridazin-3-one |
| PubChem CID | 70705601 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 2-[2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)ethyl]-6-phenyl-4,5-dihydropyridazin-3-one |
| SMILES | O=C1CCC(c2ccccc2)=NN1CCNC1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C21H29N3O3/c25-20-7-6-19(17-4-2-1-3-5-17)23-24(20)12-11-22-18-8-13-27-21(16-18)9-14-26-15-10-21/h1-5,18,22H,6-16H2 |
| InChIKey | BXEDTFMWHABPSC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)ethyl]-6-phenyl-4,5-dihydropyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)ethyl]-6-phenyl-4,5-dihydropyridazin-3-one?
The IUPAC name of 2-[2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)ethyl]-6-phenyl-4,5-dihydropyridazin-3-one (CID 70705601) is 2-[2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)ethyl]-6-phenyl-4,5-dihydropyridazin-3-one.
What is the SMILES notation for 2-[2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)ethyl]-6-phenyl-4,5-dihydropyridazin-3-one?
The canonical SMILES for 2-[2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)ethyl]-6-phenyl-4,5-dihydropyridazin-3-one is O=C1CCC(c2ccccc2)=NN1CCNC1CCOC2(CCOCC2)C1.
What is the InChIKey of 2-[2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)ethyl]-6-phenyl-4,5-dihydropyridazin-3-one?
The InChIKey is BXEDTFMWHABPSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29N3O3/c25-20-7-6-19(17-4-2-1-3-5-17)23-24(20)12-11-22-18-8-13-27-21(16-18)9-14-26-15-10-21/h1-5,18,22H,6-16H2.
What are the key properties of 2-[2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)ethyl]-6-phenyl-4,5-dihydropyridazin-3-one?
2-[2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)ethyl]-6-phenyl-4,5-dihydropyridazin-3-one has a molecular weight of 371.48 g/mol, XLogP of 2.33, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)ethyl]-6-phenyl-4,5-dihydropyridazin-3-one is sourced from PubChem (CID 70705601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).