C11H14N2O4S — CID 7070783
2-[(3S)-1,1-dioxothiolan-3-yl]-N-(2-oxo-1H-pyridin-3-yl)acetamide (PubChem CID 7070783) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-[(3S)-1,1-dioxothiolan-3-yl]-N-(2-oxo-1H-pyridin-3-yl)acetamide.
| Compound Name | 2-[(3S)-1,1-dioxothiolan-3-yl]-N-(2-oxo-1H-pyridin-3-yl)acetamide |
|---|---|
| PubChem CID | 7070783 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-[(3S)-1,1-dioxothiolan-3-yl]-N-(2-oxo-1H-pyridin-3-yl)acetamide |
| SMILES | O=C(C[C@H]1CCS(=O)(=O)C1)Nc1ccc[nH]c1=O |
| InChI | InChI=1S/C11H14N2O4S/c14-10(6-8-3-5-18(16,17)7-8)13-9-2-1-4-12-11(9)15/h1-2,4,8H,3,5-7H2,(H,12,15)(H,13,14)/t8-/m1/s1 |
| InChIKey | YHOVOADEKFPQCK-MRVPVSSYSA-N |
| XLogP | 0.14 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |