C20H26N4 — CID 70707913
2-[(1R,5R)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]quinoxaline (PubChem CID 70707913) has the molecular formula C20H26N4 and a molecular weight of 322.46 g/mol. Its IUPAC name is 2-[(1R,5R)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]quinoxaline.
| Compound Name | 2-[(1R,5R)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]quinoxaline |
|---|---|
| PubChem CID | 70707913 |
| Molecular Formula | C20H26N4 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | 2-[(1R,5R)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]quinoxaline |
| SMILES | CC(C)=CCN1C[C@H]2CC[C@@H]1CN(c1cnc3ccccc3n1)C2 |
| InChI | InChI=1S/C20H26N4/c1-15(2)9-10-23-12-16-7-8-17(23)14-24(13-16)20-11-21-18-5-3-4-6-19(18)22-20/h3-6,9,11,16-17H,7-8,10,12-14H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | BEWRLJDMGKTJHO-IAGOWNOFSA-N |
| XLogP | 3.50 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|