C19H16N4O3 — CID 70708364
2-[5-[2-(1,3-benzodioxol-5-yl)imidazol-1-yl]benzimidazol-1-yl]ethanol (PubChem CID 70708364) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is 2-[5-[2-(1,3-benzodioxol-5-yl)imidazol-1-yl]benzimidazol-1-yl]ethanol.
| Compound Name | 2-[5-[2-(1,3-benzodioxol-5-yl)imidazol-1-yl]benzimidazol-1-yl]ethanol |
|---|---|
| PubChem CID | 70708364 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-[5-[2-(1,3-benzodioxol-5-yl)imidazol-1-yl]benzimidazol-1-yl]ethanol |
| SMILES | OCCn1cnc2cc(-n3ccnc3-c3ccc4c(c3)OCO4)ccc21 |
| InChI | InChI=1S/C19H16N4O3/c24-8-7-22-11-21-15-10-14(2-3-16(15)22)23-6-5-20-19(23)13-1-4-17-18(9-13)26-12-25-17/h1-6,9-11,24H,7-8,12H2 |
| InChIKey | LDXZTNOQRQNFFE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |