C17H30N4O2 — CID 70710284
[(3S)-3-(dimethylamino)azepan-1-yl]-[2-(2-ethoxyethyl)-5-methylpyrazol-3-yl]methanone (PubChem CID 70710284) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is [(3S)-3-(dimethylamino)azepan-1-yl]-[2-(2-ethoxyethyl)-5-methylpyrazol-3-yl]methanone.
| Compound Name | [(3S)-3-(dimethylamino)azepan-1-yl]-[2-(2-ethoxyethyl)-5-methylpyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 70710284 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | [(3S)-3-(dimethylamino)azepan-1-yl]-[2-(2-ethoxyethyl)-5-methylpyrazol-3-yl]methanone |
| SMILES | CCOCCn1nc(C)cc1C(=O)N1CCCC[C@H](N(C)C)C1 |
| InChI | InChI=1S/C17H30N4O2/c1-5-23-11-10-21-16(12-14(2)18-21)17(22)20-9-7-6-8-15(13-20)19(3)4/h12,15H,5-11,13H2,1-4H3/t15-/m0/s1 |
| InChIKey | DVJBKBAPCNHJMJ-HNNXBMFYSA-N |
| XLogP | 1.78 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|