C16H23N3O4 — CID 70731385
ethyl 2-[1-[2-(3-methyl-6-oxopyridazin-1-yl)acetyl]piperidin-2-yl]acetate (PubChem CID 70731385) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is ethyl 2-[1-[2-(3-methyl-6-oxopyridazin-1-yl)acetyl]piperidin-2-yl]acetate.
| Compound Name | ethyl 2-[1-[2-(3-methyl-6-oxopyridazin-1-yl)acetyl]piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 70731385 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | ethyl 2-[1-[2-(3-methyl-6-oxopyridazin-1-yl)acetyl]piperidin-2-yl]acetate |
| SMILES | CCOC(=O)CC1CCCCN1C(=O)Cn1nc(C)ccc1=O |
| InChI | InChI=1S/C16H23N3O4/c1-3-23-16(22)10-13-6-4-5-9-18(13)15(21)11-19-14(20)8-7-12(2)17-19/h7-8,13H,3-6,9-11H2,1-2H3 |
| InChIKey | ZMANEVHCDLIEGL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |