C16H20N4O4S — CID 70739425
4-(3-hydroxypyrrolidin-1-yl)sulfonyl-N-[2-(1H-imidazol-5-yl)ethyl]benzamide (PubChem CID 70739425) has the molecular formula C16H20N4O4S and a molecular weight of 364.43 g/mol. Its IUPAC name is 4-(3-hydroxypyrrolidin-1-yl)sulfonyl-N-[2-(1H-imidazol-5-yl)ethyl]benzamide.
| Compound Name | 4-(3-hydroxypyrrolidin-1-yl)sulfonyl-N-[2-(1H-imidazol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 70739425 |
| Molecular Formula | C16H20N4O4S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 4-(3-hydroxypyrrolidin-1-yl)sulfonyl-N-[2-(1H-imidazol-5-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1cnc[nH]1)c1ccc(S(=O)(=O)N2CCC(O)C2)cc1 |
| InChI | InChI=1S/C16H20N4O4S/c21-14-6-8-20(10-14)25(23,24)15-3-1-12(2-4-15)16(22)18-7-5-13-9-17-11-19-13/h1-4,9,11,14,21H,5-8,10H2,(H,17,19)(H,18,22) |
| InChIKey | FRHXAPVYLAIIHU-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |