C16H21N5O3S — CID 97127601
4-[(3R)-3-aminopyrrolidin-1-yl]sulfonyl-N-(2-pyrazol-1-ylethyl)benzamide (PubChem CID 97127601) has the molecular formula C16H21N5O3S and a molecular weight of 363.44 g/mol. Its IUPAC name is 4-[(3R)-3-aminopyrrolidin-1-yl]sulfonyl-N-(2-pyrazol-1-ylethyl)benzamide.
| Compound Name | 4-[(3R)-3-aminopyrrolidin-1-yl]sulfonyl-N-(2-pyrazol-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 97127601 |
| Molecular Formula | C16H21N5O3S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 4-[(3R)-3-aminopyrrolidin-1-yl]sulfonyl-N-(2-pyrazol-1-ylethyl)benzamide |
| SMILES | N[C@@H]1CCN(S(=O)(=O)c2ccc(C(=O)NCCn3cccn3)cc2)C1 |
| InChI | InChI=1S/C16H21N5O3S/c17-14-6-10-21(12-14)25(23,24)15-4-2-13(3-5-15)16(22)18-8-11-20-9-1-7-19-20/h1-5,7,9,14H,6,8,10-12,17H2,(H,18,22)/t14-/m1/s1 |
| InChIKey | JIYIYNGJGUVFKI-CQSZACIVSA-N |
| XLogP | 0.03 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |