C19H23N7 — CID 70742409
4-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 70742409) has the molecular formula C19H23N7 and a molecular weight of 349.44 g/mol. Its IUPAC name is 4-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 4-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 70742409 |
| Molecular Formula | C19H23N7 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 4-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | Nc1nc2c(c(NCc3ccccc3Cn3cccn3)n1)CCNCC2 |
| InChI | InChI=1S/C19H23N7/c20-19-24-17-7-10-21-9-6-16(17)18(25-19)22-12-14-4-1-2-5-15(14)13-26-11-3-8-23-26/h1-5,8,11,21H,6-7,9-10,12-13H2,(H3,20,22,24,25) |
| InChIKey | VFCSLHWJMHZAHL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |