C12H11F3O4S — CID 7075415
3-(benzenesulfonylmethyl)-5,5,5-trifluoro-4-hydroxypent-3-en-2-one (PubChem CID 7075415) has the molecular formula C12H11F3O4S and a molecular weight of 308.28 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-5,5,5-trifluoro-4-hydroxypent-3-en-2-one.
| Compound Name | 3-(benzenesulfonylmethyl)-5,5,5-trifluoro-4-hydroxypent-3-en-2-one |
|---|---|
| PubChem CID | 7075415 |
| Molecular Formula | C12H11F3O4S |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-5,5,5-trifluoro-4-hydroxypent-3-en-2-one |
| SMILES | CC(=O)C(CS(=O)(=O)c1ccccc1)=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H11F3O4S/c1-8(16)10(11(17)12(13,14)15)7-20(18,19)9-5-3-2-4-6-9/h2-6,17H,7H2,1H3 |
| InChIKey | MIYAFSUULPUUTL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|