C22H24N4O3 — CID 70769602
2-[3-benzyl-1-(4-methoxyphenyl)-5-oxo-1,2,4-triazol-4-yl]-N-methyl-N-prop-2-enylacetamide (PubChem CID 70769602) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-[3-benzyl-1-(4-methoxyphenyl)-5-oxo-1,2,4-triazol-4-yl]-N-methyl-N-prop-2-enylacetamide.
| Compound Name | 2-[3-benzyl-1-(4-methoxyphenyl)-5-oxo-1,2,4-triazol-4-yl]-N-methyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 70769602 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-[3-benzyl-1-(4-methoxyphenyl)-5-oxo-1,2,4-triazol-4-yl]-N-methyl-N-prop-2-enylacetamide |
| SMILES | C=CCN(C)C(=O)Cn1c(Cc2ccccc2)nn(-c2ccc(OC)cc2)c1=O |
| InChI | InChI=1S/C22H24N4O3/c1-4-14-24(2)21(27)16-25-20(15-17-8-6-5-7-9-17)23-26(22(25)28)18-10-12-19(29-3)13-11-18/h4-13H,1,14-16H2,2-3H3 |
| InChIKey | XPRPOXWKYPPYSI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|