C16H27N5O3S — CID 70769989
5-[[(4aR,7aS)-1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]methyl]-N,N-dimethylpyrimidin-2-amine (PubChem CID 70769989) has the molecular formula C16H27N5O3S and a molecular weight of 369.49 g/mol. Its IUPAC name is 5-[[(4aR,7aS)-1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]methyl]-N,N-dimethylpyrimidin-2-amine.
| Compound Name | 5-[[(4aR,7aS)-1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]methyl]-N,N-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 70769989 |
| Molecular Formula | C16H27N5O3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 5-[[(4aR,7aS)-1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]methyl]-N,N-dimethylpyrimidin-2-amine |
| SMILES | COCCN1CCN(Cc2cnc(N(C)C)nc2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H27N5O3S/c1-19(2)16-17-8-13(9-18-16)10-21-5-4-20(6-7-24-3)14-11-25(22,23)12-15(14)21/h8-9,14-15H,4-7,10-12H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | DYKLMSSTDWBWIT-CABCVRRESA-N |
| XLogP | -0.53 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |