C25H25FN2O3 — CID 70778330
[(3aS,6aS)-2-[[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-7-yl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methanol (PubChem CID 70778330) has the molecular formula C25H25FN2O3 and a molecular weight of 420.48 g/mol. Its IUPAC name is [(3aS,6aS)-2-[[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-7-yl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methanol.
| Compound Name | [(3aS,6aS)-2-[[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-7-yl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 70778330 |
| Molecular Formula | C25H25FN2O3 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | [(3aS,6aS)-2-[[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-7-yl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methanol |
| SMILES | OC[C@@]12CCC[C@@H]1CN(Cc1cc3cc4c(cc3nc1-c1ccc(F)cc1)OCO4)C2 |
| InChI | InChI=1S/C25H25FN2O3/c26-20-5-3-16(4-6-20)24-18(11-28-12-19-2-1-7-25(19,13-28)14-29)8-17-9-22-23(31-15-30-22)10-21(17)27-24/h3-6,8-10,19,29H,1-2,7,11-15H2/t19-,25+/m1/s1 |
| InChIKey | OPBDRUDTICQUKQ-CLOONOSVSA-N |
| XLogP | 4.36 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |