C20H33NO5 — CID 7078317
(1R,3S,4R,5R,8R,10R,14S)-5-[[2,2-dimethoxyethyl(methyl)amino]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one (PubChem CID 7078317) has the molecular formula C20H33NO5 and a molecular weight of 367.49 g/mol. Its IUPAC name is (1R,3S,4R,5R,8R,10R,14S)-5-[[2,2-dimethoxyethyl(methyl)amino]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one.
| Compound Name | (1R,3S,4R,5R,8R,10R,14S)-5-[[2,2-dimethoxyethyl(methyl)amino]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
|---|---|
| PubChem CID | 7078317 |
| Molecular Formula | C20H33NO5 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | (1R,3S,4R,5R,8R,10R,14S)-5-[[2,2-dimethoxyethyl(methyl)amino]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
| SMILES | COC(CN(C)C[C@@H]1C(=O)O[C@@H]2C[C@@]3(C)CCC[C@H](C)[C@@]34O[C@H]4[C@H]12)OC |
| InChI | InChI=1S/C20H33NO5/c1-12-7-6-8-19(2)9-14-16(17-20(12,19)26-17)13(18(22)25-14)10-21(3)11-15(23-4)24-5/h12-17H,6-11H2,1-5H3/t12-,13-,14+,16+,17-,19+,20-/m0/s1 |
| InChIKey | VDNOZODENXPGDB-VEPVZFAASA-N |
| XLogP | 2.06 |
| TPSA | 60.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|