C19H14ClN3O4 — CID 70787811
N-[2-chloro-5-[2-[5-(hydroxymethyl)furan-2-yl]imidazol-1-yl]phenyl]furan-2-carboxamide (PubChem CID 70787811) has the molecular formula C19H14ClN3O4 and a molecular weight of 383.79 g/mol. Its IUPAC name is N-[2-chloro-5-[2-[5-(hydroxymethyl)furan-2-yl]imidazol-1-yl]phenyl]furan-2-carboxamide.
| Compound Name | N-[2-chloro-5-[2-[5-(hydroxymethyl)furan-2-yl]imidazol-1-yl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 70787811 |
| Molecular Formula | C19H14ClN3O4 |
| Molecular Weight | 383.79 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | N-[2-chloro-5-[2-[5-(hydroxymethyl)furan-2-yl]imidazol-1-yl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cc(-n2ccnc2-c2ccc(CO)o2)ccc1Cl)c1ccco1 |
| InChI | InChI=1S/C19H14ClN3O4/c20-14-5-3-12(10-15(14)22-19(25)17-2-1-9-26-17)23-8-7-21-18(23)16-6-4-13(11-24)27-16/h1-10,24H,11H2,(H,22,25) |
| InChIKey | SBTGWFNHKHHSLN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.79 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |