About S-quinolin-8-yl cyclohexanecarbothioate
S-quinolin-8-yl cyclohexanecarbothioate (PubChem CID 70789803) has the molecular formula C16H17NOS
and a molecular weight of 271.38 g/mol. Its IUPAC name is S-quinolin-8-yl cyclohexanecarbothioate.
Molecular Properties
| Compound Name | S-quinolin-8-yl cyclohexanecarbothioate |
| PubChem CID | 70789803 |
| Molecular Formula | C16H17NOS |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | S-quinolin-8-yl cyclohexanecarbothioate |
| SMILES | O=C(Sc1cccc2cccnc12)C1CCCCC1 |
| InChI | InChI=1S/C16H17NOS/c18-16(13-6-2-1-3-7-13)19-14-10-4-8-12-9-5-11-17-15(12)14/h4-5,8-11,13H,1-3,6-7H2 |
| InChIKey | HIFJZIAUMLOBCD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-quinolin-8-yl cyclohexanecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-quinolin-8-yl cyclohexanecarbothioate?
The IUPAC name of S-quinolin-8-yl cyclohexanecarbothioate (CID 70789803) is S-quinolin-8-yl cyclohexanecarbothioate.
What is the SMILES notation for S-quinolin-8-yl cyclohexanecarbothioate?
The canonical SMILES for S-quinolin-8-yl cyclohexanecarbothioate is O=C(Sc1cccc2cccnc12)C1CCCCC1.
What is the InChIKey of S-quinolin-8-yl cyclohexanecarbothioate?
The InChIKey is HIFJZIAUMLOBCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NOS/c18-16(13-6-2-1-3-7-13)19-14-10-4-8-12-9-5-11-17-15(12)14/h4-5,8-11,13H,1-3,6-7H2.
What are the key properties of S-quinolin-8-yl cyclohexanecarbothioate?
S-quinolin-8-yl cyclohexanecarbothioate has a molecular weight of 271.38 g/mol, XLogP of 4.43, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-quinolin-8-yl cyclohexanecarbothioate is sourced from PubChem (CID 70789803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).